C7H9FN4O2 — CID 20792101
(6-fluoro-4,5-dimethyl-3-nitro-2-pyridinyl)hydrazine (PubChem CID 20792101) has the molecular formula C7H9FN4O2 and a molecular weight of 200.17 g/mol. Its IUPAC name is (6-fluoro-4,5-dimethyl-3-nitro-2-pyridinyl)hydrazine.
| Compound Name | (6-fluoro-4,5-dimethyl-3-nitro-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 20792101 |
| Molecular Formula | C7H9FN4O2 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (6-fluoro-4,5-dimethyl-3-nitro-2-pyridinyl)hydrazine |
| SMILES | Cc1c(F)nc(NN)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C7H9FN4O2/c1-3-4(2)6(8)10-7(11-9)5(3)12(13)14/h9H2,1-2H3,(H,10,11) |
| InChIKey | NXKYXQYGJPYJDC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|