C20H17Cl2N3O3 — CID 20795149
(2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(5-methoxy-3-pyridinyl)penta-2,4-dienamide (PubChem CID 20795149) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(5-methoxy-3-pyridinyl)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(5-methoxy-3-pyridinyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 20795149 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(5-methoxy-3-pyridinyl)penta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)Nc1cncc(OC)c1 |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-27-15-8-14(10-23-11-15)25-20(26)19(28-2)5-3-4-13-6-12-7-16(21)17(22)9-18(12)24-13/h3-11,24H,1-2H3,(H,25,26)/b4-3+,19-5- |
| InChIKey | YOOHHIIAQIEANZ-GAWKTNFTSA-N |
| XLogP | 5.06 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|