C18H21Cl2N3OS — CID 20845630
1-(1-adamantylsulfanyl)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]urea (PubChem CID 20845630) has the molecular formula C18H21Cl2N3OS and a molecular weight of 398.36 g/mol. Its IUPAC name is 1-(1-adamantylsulfanyl)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]urea.
| Compound Name | 1-(1-adamantylsulfanyl)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 20845630 |
| Molecular Formula | C18H21Cl2N3OS |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-(1-adamantylsulfanyl)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1c(Cl)cccc1Cl)NSC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H21Cl2N3OS/c19-15-2-1-3-16(20)14(15)10-21-22-17(24)23-25-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,10-13H,4-9H2,(H2,22,23,24)/b21-10+ |
| InChIKey | WMHJCMHMJDCYDC-UFFVCSGVSA-N |
| XLogP | 5.24 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|