C43H36Br2N2 — CID 21028027
2-N-[2,6-bis(4-methylphenyl)-4-phenylphenyl]-3-N-[2,4-dibromo-6-(4-methylphenyl)phenyl]butane-2,3-diimine (PubChem CID 21028027) has the molecular formula C43H36Br2N2 and a molecular weight of 740.58 g/mol. Its IUPAC name is 2-N-[2,6-bis(4-methylphenyl)-4-phenylphenyl]-3-N-[2,4-dibromo-6-(4-methylphenyl)phenyl]butane-2,3-diimine.
| Compound Name | 2-N-[2,6-bis(4-methylphenyl)-4-phenylphenyl]-3-N-[2,4-dibromo-6-(4-methylphenyl)phenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 21028027 |
| Molecular Formula | C43H36Br2N2 |
| Molecular Weight | 740.58 g/mol |
| Exact Mass | 738.12 |
| IUPAC Name | 2-N-[2,6-bis(4-methylphenyl)-4-phenylphenyl]-3-N-[2,4-dibromo-6-(4-methylphenyl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1c(Br)cc(Br)cc1-c1ccc(C)cc1)/C(C)=N/c1c(-c2ccc(C)cc2)cc(-c2ccccc2)cc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C43H36Br2N2/c1-27-11-17-33(18-12-27)38-23-36(32-9-7-6-8-10-32)24-39(34-19-13-28(2)14-20-34)42(38)46-30(4)31(5)47-43-40(25-37(44)26-41(43)45)35-21-15-29(3)16-22-35/h6-26H,1-5H3/b46-30+,47-31+ |
| InChIKey | LVSSPBNOUVCSCR-DWBUZRECSA-N |
| XLogP | 13.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.58 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|