C18H17NO3S — CID 21108704
4-[2-(2-phenoxyethylsulfanylmethyl)-1,3-oxazol-4-yl]phenol (PubChem CID 21108704) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-[2-(2-phenoxyethylsulfanylmethyl)-1,3-oxazol-4-yl]phenol.
| Compound Name | 4-[2-(2-phenoxyethylsulfanylmethyl)-1,3-oxazol-4-yl]phenol |
|---|---|
| PubChem CID | 21108704 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-[2-(2-phenoxyethylsulfanylmethyl)-1,3-oxazol-4-yl]phenol |
| SMILES | Oc1ccc(-c2coc(CSCCOc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c20-15-8-6-14(7-9-15)17-12-22-18(19-17)13-23-11-10-21-16-4-2-1-3-5-16/h1-9,12,20H,10-11,13H2 |
| InChIKey | SGGPOBLJULRNQM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|