C24H26N2O2S — CID 2116063
(2R)-1-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 2116063) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is (2R)-1-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 2116063 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R)-1-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | O[C@H](CNC[C@@H](c1ccccc1)c1c[nH]c2ccccc12)COCc1cccs1 |
| InChI | InChI=1S/C24H26N2O2S/c27-19(16-28-17-20-9-6-12-29-20)13-25-14-22(18-7-2-1-3-8-18)23-15-26-24-11-5-4-10-21(23)24/h1-12,15,19,22,25-27H,13-14,16-17H2/t19-,22+/m1/s1 |
| InChIKey | NOCUORWSMDGQHN-KNQAVFIVSA-N |
| XLogP | 4.53 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |