C17H13ClO4 — CID 21163210
6-chloro-4-ethenyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid (PubChem CID 21163210) has the molecular formula C17H13ClO4 and a molecular weight of 316.74 g/mol. Its IUPAC name is 6-chloro-4-ethenyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 6-chloro-4-ethenyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 21163210 |
| Molecular Formula | C17H13ClO4 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 6-chloro-4-ethenyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid |
| SMILES | C=CC1(c2ccccc2)OC(C(=O)O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H13ClO4/c1-2-17(11-6-4-3-5-7-11)13-10-12(18)8-9-14(13)21-16(22-17)15(19)20/h2-10,16H,1H2,(H,19,20) |
| InChIKey | XLVVSNJASCDULQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|