C21H18I4N4O3 — CID 21214312
1-[(E)-(2,4-diiodo-6-prop-2-enoxyphenyl)methylideneamino]-3-[(3,5-diiodo-2-prop-2-enoxyphenyl)methylideneamino]urea (PubChem CID 21214312) has the molecular formula C21H18I4N4O3 and a molecular weight of 882.02 g/mol. Its IUPAC name is 1-[(E)-(2,4-diiodo-6-prop-2-enoxyphenyl)methylideneamino]-3-[(3,5-diiodo-2-prop-2-enoxyphenyl)methylideneamino]urea.
| Compound Name | 1-[(E)-(2,4-diiodo-6-prop-2-enoxyphenyl)methylideneamino]-3-[(3,5-diiodo-2-prop-2-enoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 21214312 |
| Molecular Formula | C21H18I4N4O3 |
| Molecular Weight | 882.02 g/mol |
| Exact Mass | 881.76 |
| IUPAC Name | 1-[(E)-(2,4-diiodo-6-prop-2-enoxyphenyl)methylideneamino]-3-[(3,5-diiodo-2-prop-2-enoxyphenyl)methylideneamino]urea |
| SMILES | C=CCOc1cc(I)cc(I)c1/C=N/NC(=O)NN=Cc1cc(I)cc(I)c1OCC=C |
| InChI | InChI=1S/C21H18I4N4O3/c1-3-5-31-19-10-15(23)8-17(24)16(19)12-27-29-21(30)28-26-11-13-7-14(22)9-18(25)20(13)32-6-4-2/h3-4,7-12H,1-2,5-6H2,(H2,28,29,30)/b26-11?,27-12+ |
| InChIKey | PUUXWJWTHRIDNZ-GXKNSZKBSA-N |
| XLogP | 5.90 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.02 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|