C7H10N2S — CID 21266580
2,3,3a,4-tetrahydro-1,2-benzothiazol-4-amine (PubChem CID 21266580) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1,2-benzothiazol-4-amine.
| Compound Name | 2,3,3a,4-tetrahydro-1,2-benzothiazol-4-amine |
|---|---|
| PubChem CID | 21266580 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1,2-benzothiazol-4-amine |
| SMILES | NC1C=CC=C2SNCC21 |
| InChI | InChI=1S/C7H10N2S/c8-6-2-1-3-7-5(6)4-9-10-7/h1-3,5-6,9H,4,8H2 |
| InChIKey | QULZQWQNTAWHGG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|