C28H42Cl2N2O5 — CID 21300777
1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2-[4-butoxy-2-(hydroxymethyl)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride (PubChem CID 21300777) has the molecular formula C28H42Cl2N2O5 and a molecular weight of 557.56 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2-[4-butoxy-2-(hydroxymethyl)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2-[4-butoxy-2-(hydroxymethyl)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 21300777 |
| Molecular Formula | C28H42Cl2N2O5 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2-[4-butoxy-2-(hydroxymethyl)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride |
| SMILES | CCCCOc1ccc(N(C)CCC2(O)CCN(CCc3ccc4c(c3)OCO4)CC2)c(CO)c1.Cl.Cl |
| InChI | InChI=1S/C28H40N2O5.2ClH/c1-3-4-17-33-24-6-7-25(23(19-24)20-31)29(2)14-10-28(32)11-15-30(16-12-28)13-9-22-5-8-26-27(18-22)35-21-34-26;;/h5-8,18-19,31-32H,3-4,9-17,20-21H2,1-2H3;2*1H |
| InChIKey | KGVRUCUGJXLBKZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|