C21H22F2N2O6S — CID 21343993
ethyl (E)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 21343993) has the molecular formula C21H22F2N2O6S and a molecular weight of 468.48 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21343993 |
| Molecular Formula | C21H22F2N2O6S |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | ethyl (E)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCNC(=O)NS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)OCC)cc2F)cc1 |
| InChI | InChI=1S/C21H22F2N2O6S/c1-4-24-21(27)25-32(28,29)16-8-6-15(7-9-16)31-19-17(22)11-14(12-18(19)23)10-13(3)20(26)30-5-2/h6-12H,4-5H2,1-3H3,(H2,24,25,27)/b13-10+ |
| InChIKey | DJJVRSQAXJDGCK-JLHYYAGUSA-N |
| XLogP | 3.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|