C22H22BrNO4 — CID 21417570
2,3,10-trimethoxy-8,13-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol bromide (PubChem CID 21417570) has the molecular formula C22H22BrNO4 and a molecular weight of 444.33 g/mol. Its IUPAC name is 2,3,10-trimethoxy-8,13-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol bromide.
| Compound Name | 2,3,10-trimethoxy-8,13-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol bromide |
|---|---|
| PubChem CID | 21417570 |
| Molecular Formula | C22H22BrNO4 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2,3,10-trimethoxy-8,13-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol bromide |
| SMILES | COc1cc2cc[n+]3c(C)c4c(O)c(OC)ccc4c(C)c3c2cc1OC.[Br-] |
| InChI | InChI=1S/C22H21NO4.BrH/c1-12-15-6-7-17(25-3)22(24)20(15)13(2)23-9-8-14-10-18(26-4)19(27-5)11-16(14)21(12)23;/h6-11H,1-5H3;1H |
| InChIKey | CGLBUKNXTJVRRL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|