C24H22N4O3 — CID 22030706
N-(2,3-dimethyl-1H-indol-5-yl)-7-(furan-2-ylmethoxy)-6-methoxyquinazolin-4-amine (PubChem CID 22030706) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-(2,3-dimethyl-1H-indol-5-yl)-7-(furan-2-ylmethoxy)-6-methoxyquinazolin-4-amine.
| Compound Name | N-(2,3-dimethyl-1H-indol-5-yl)-7-(furan-2-ylmethoxy)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 22030706 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(2,3-dimethyl-1H-indol-5-yl)-7-(furan-2-ylmethoxy)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc4[nH]c(C)c(C)c4c3)ncnc2cc1OCc1ccco1 |
| InChI | InChI=1S/C24H22N4O3/c1-14-15(2)27-20-7-6-16(9-18(14)20)28-24-19-10-22(29-3)23(11-21(19)25-13-26-24)31-12-17-5-4-8-30-17/h4-11,13,27H,12H2,1-3H3,(H,25,26,28) |
| InChIKey | YITAFYXGPMUAOX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|