C25H38F3NO5 — CID 22085221
methyl 7-[5-hydroxy-3-(hydroxyamino)-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate (PubChem CID 22085221) has the molecular formula C25H38F3NO5 and a molecular weight of 489.58 g/mol. Its IUPAC name is methyl 7-[5-hydroxy-3-(hydroxyamino)-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[5-hydroxy-3-(hydroxyamino)-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22085221 |
| Molecular Formula | C25H38F3NO5 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | methyl 7-[5-hydroxy-3-(hydroxyamino)-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(O)CC(NO)C1CCC(O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H38F3NO5/c1-34-24(32)10-5-3-2-4-9-21-20(22(29-33)16-23(21)31)14-13-19(30)12-11-17-7-6-8-18(15-17)25(26,27)28/h6-8,15,19-23,29-31,33H,2-5,9-14,16H2,1H3 |
| InChIKey | AGRINGXCFFWBIW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|