C41H33NO4 — CID 22089763
2-[4-[4-(fluoren-9-ylidenemethyl)-N-[3-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate (PubChem CID 22089763) has the molecular formula C41H33NO4 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-[4-[4-(fluoren-9-ylidenemethyl)-N-[3-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[4-(fluoren-9-ylidenemethyl)-N-[3-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 22089763 |
| Molecular Formula | C41H33NO4 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 2-[4-[4-(fluoren-9-ylidenemethyl)-N-[3-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(c2ccc(C=C3c4ccccc4-c4ccccc43)cc2)c2cccc(COC(=O)C=C)c2)cc1 |
| InChI | InChI=1S/C41H33NO4/c1-3-40(43)45-25-24-29-16-20-32(21-17-29)42(34-11-9-10-31(26-34)28-46-41(44)4-2)33-22-18-30(19-23-33)27-39-37-14-7-5-12-35(37)36-13-6-8-15-38(36)39/h3-23,26-27H,1-2,24-25,28H2 |
| InChIKey | XOESGUOMDGTVKL-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|