C22H34N2O4S — CID 22175243
[1-[7-butoxy-5-(2,2-dimethylpropyl)-4-oxothieno[3,2-c]pyridin-6-yl]-2,2-dimethylpropyl]carbamic acid (PubChem CID 22175243) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is [1-[7-butoxy-5-(2,2-dimethylpropyl)-4-oxothieno[3,2-c]pyridin-6-yl]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-[7-butoxy-5-(2,2-dimethylpropyl)-4-oxothieno[3,2-c]pyridin-6-yl]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 22175243 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [1-[7-butoxy-5-(2,2-dimethylpropyl)-4-oxothieno[3,2-c]pyridin-6-yl]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CCCCOc1c(C(NC(=O)O)C(C)(C)C)n(CC(C)(C)C)c(=O)c2ccsc12 |
| InChI | InChI=1S/C22H34N2O4S/c1-8-9-11-28-16-15(18(22(5,6)7)23-20(26)27)24(13-21(2,3)4)19(25)14-10-12-29-17(14)16/h10,12,18,23H,8-9,11,13H2,1-7H3,(H,26,27) |
| InChIKey | YFCODVJCWOUQHA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|