C21H42N2O9Si3 — CID 22217424
1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[hydroxy(trimethylsilyloxy)methyl]-3-trimethylsilyloxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22217424) has the molecular formula C21H42N2O9Si3 and a molecular weight of 550.83 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[hydroxy(trimethylsilyloxy)methyl]-3-trimethylsilyloxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[hydroxy(trimethylsilyloxy)methyl]-3-trimethylsilyloxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22217424 |
| Molecular Formula | C21H42N2O9Si3 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[hydroxy(trimethylsilyloxy)methyl]-3-trimethylsilyloxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(O)[C@@H](C(O)O[Si](C)(C)C)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@]1(O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H42N2O9Si3/c1-19(2,3)35(10,11)32-20(27)15(16(25)30-33(4,5)6)29-17(21(20,28)31-34(7,8)9)23-13-12-14(24)22-18(23)26/h12-13,15-17,25,27-28H,1-11H3,(H,22,24,26)/t15-,16?,17-,20+,21-/m1/s1 |
| InChIKey | JWQVNXDRTUENEP-UGTZNDKLSA-N |
| XLogP | 1.85 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|