C14H18N2O — CID 22294970
(4aR,8aS)-N-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-2-amine (PubChem CID 22294970) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (4aR,8aS)-N-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-2-amine.
| Compound Name | (4aR,8aS)-N-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-2-amine |
|---|---|
| PubChem CID | 22294970 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (4aR,8aS)-N-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-2-amine |
| SMILES | c1ccc(NC2=NC[C@H]3CCCC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-2-7-12(8-3-1)16-14-15-10-11-6-4-5-9-13(11)17-14/h1-3,7-8,11,13H,4-6,9-10H2,(H,15,16)/t11-,13+/m1/s1 |
| InChIKey | LUNKCLXURLIUPC-YPMHNXCESA-N |
| XLogP | 3.04 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |