C15H17N3 — CID 22298167
5-(1-methylpyrrolidin-2-yl)-2-pyridin-2-ylpyridine (PubChem CID 22298167) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-(1-methylpyrrolidin-2-yl)-2-pyridin-2-ylpyridine.
| Compound Name | 5-(1-methylpyrrolidin-2-yl)-2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 22298167 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5-(1-methylpyrrolidin-2-yl)-2-pyridin-2-ylpyridine |
| SMILES | CN1CCCC1c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H17N3/c1-18-10-4-6-15(18)12-7-8-14(17-11-12)13-5-2-3-9-16-13/h2-3,5,7-9,11,15H,4,6,10H2,1H3 |
| InChIKey | PQWMAJLNLACYDL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |