C18H18Cl2N2O3S — CID 22301216
4-(2,4-dichlorophenoxy)-N-[methyl(phenylsulfanyl)carbamoyl]butanamide (PubChem CID 22301216) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[methyl(phenylsulfanyl)carbamoyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[methyl(phenylsulfanyl)carbamoyl]butanamide |
|---|---|
| PubChem CID | 22301216 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[methyl(phenylsulfanyl)carbamoyl]butanamide |
| SMILES | CN(Sc1ccccc1)C(=O)NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-22(26-14-6-3-2-4-7-14)18(24)21-17(23)8-5-11-25-16-10-9-13(19)12-15(16)20/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,21,23,24) |
| InChIKey | AAUKWSFSVGFKCM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|