C23H20Cl4N2O3S2 — CID 22305039
2-[4-(benzenesulfonyl)-2,3-dichloroanilino]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 22305039) has the molecular formula C23H20Cl4N2O3S2 and a molecular weight of 578.37 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)-2,3-dichloroanilino]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)-2,3-dichloroanilino]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 22305039 |
| Molecular Formula | C23H20Cl4N2O3S2 |
| Molecular Weight | 578.37 g/mol |
| Exact Mass | 575.97 |
| IUPAC Name | 2-[4-(benzenesulfonyl)-2,3-dichloroanilino]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CNc1ccc(S(=O)(=O)c2ccccc2)c(Cl)c1Cl)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl4N2O3S2/c24-16-7-6-15(18(25)12-16)14-33-11-10-28-21(30)13-29-19-8-9-20(23(27)22(19)26)34(31,32)17-4-2-1-3-5-17/h1-9,12,29H,10-11,13-14H2,(H,28,30) |
| InChIKey | GXURVGVAXDUGDR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.37 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|