C18H19BrCl2N2O3S2 — CID 22305027
2-(2-bromo-3-methylsulfonylanilino)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 22305027) has the molecular formula C18H19BrCl2N2O3S2 and a molecular weight of 526.31 g/mol. Its IUPAC name is 2-(2-bromo-3-methylsulfonylanilino)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(2-bromo-3-methylsulfonylanilino)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 22305027 |
| Molecular Formula | C18H19BrCl2N2O3S2 |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 523.94 |
| IUPAC Name | 2-(2-bromo-3-methylsulfonylanilino)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | CS(=O)(=O)c1cccc(NCC(=O)NCCSCc2ccc(Cl)cc2Cl)c1Br |
| InChI | InChI=1S/C18H19BrCl2N2O3S2/c1-28(25,26)16-4-2-3-15(18(16)19)23-10-17(24)22-7-8-27-11-12-5-6-13(20)9-14(12)21/h2-6,9,23H,7-8,10-11H2,1H3,(H,22,24) |
| InChIKey | LXKAVPOFKCMKSZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|