C14H24OS2 — CID 22421052
5-tert-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane 1-oxide (PubChem CID 22421052) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is 5-tert-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane 1-oxide.
| Compound Name | 5-tert-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 22421052 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-tert-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane 1-oxide |
| SMILES | CC(C)(C)C#CC1SCC(C(C)(C)C)CS1=O |
| InChI | InChI=1S/C14H24OS2/c1-13(2,3)8-7-12-16-9-11(10-17(12)15)14(4,5)6/h11-12H,9-10H2,1-6H3 |
| InChIKey | FYPKYJKPELWKDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|