C27H37N3O6SSi — CID 22573185
N-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-oxo-1-phenylethyl]-2-nitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 22573185) has the molecular formula C27H37N3O6SSi and a molecular weight of 559.76 g/mol. Its IUPAC name is N-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-oxo-1-phenylethyl]-2-nitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-oxo-1-phenylethyl]-2-nitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 22573185 |
| Molecular Formula | C27H37N3O6SSi |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | N-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-oxo-1-phenylethyl]-2-nitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C(C(=O)N1CCC(O[Si](C)(C)C(C)(C)C)C1)c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H37N3O6SSi/c1-7-18-29(37(34,35)24-16-12-11-15-23(24)30(32)33)25(21-13-9-8-10-14-21)26(31)28-19-17-22(20-28)36-38(5,6)27(2,3)4/h7-16,22,25H,1,17-20H2,2-6H3 |
| InChIKey | CBIABZHXDGOJQV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|