C15H16N2O5 — CID 22612854
4-amino-2-(1,3-dioxo-4-propan-2-ylisoindol-2-yl)-4-oxobutanoic acid (PubChem CID 22612854) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-amino-2-(1,3-dioxo-4-propan-2-ylisoindol-2-yl)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(1,3-dioxo-4-propan-2-ylisoindol-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22612854 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-amino-2-(1,3-dioxo-4-propan-2-ylisoindol-2-yl)-4-oxobutanoic acid |
| SMILES | CC(C)c1cccc2c1C(=O)N(C(CC(N)=O)C(=O)O)C2=O |
| InChI | InChI=1S/C15H16N2O5/c1-7(2)8-4-3-5-9-12(8)14(20)17(13(9)19)10(15(21)22)6-11(16)18/h3-5,7,10H,6H2,1-2H3,(H2,16,18)(H,21,22) |
| InChIKey | JGYBMOPXWMVNLQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|