C29H42NO4S- — CID 22636077
N-[2,6-di(propan-2-yl)phenyl]-N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate (PubChem CID 22636077) has the molecular formula C29H42NO4S- and a molecular weight of 500.73 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate |
|---|---|
| PubChem CID | 22636077 |
| Molecular Formula | C29H42NO4S- |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate |
| SMILES | CC(C)c1cc(C(C)C)c(CC(=O)N(c2c(C(C)C)cccc2C(C)C)S(=O)(=O)[O-])c(C(C)C)c1 |
| InChI | InChI=1S/C29H43NO4S/c1-17(2)22-14-25(20(7)8)27(26(15-22)21(9)10)16-28(31)30(35(32,33)34)29-23(18(3)4)12-11-13-24(29)19(5)6/h11-15,17-21H,16H2,1-10H3,(H,32,33,34)/p-1 |
| InChIKey | SFASBVAAXQUPLR-UHFFFAOYSA-M |
| XLogP | 7.34 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|