About 9-(3-chloropropyl)purine
9-(3-chloropropyl)purine (PubChem CID 22715671) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 9-(3-chloropropyl)purine.
Molecular Properties
| Compound Name | 9-(3-chloropropyl)purine |
| PubChem CID | 22715671 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 9-(3-chloropropyl)purine |
| SMILES | ClCCCn1cnc2cncnc21 |
| InChI | InChI=1S/C8H9ClN4/c9-2-1-3-13-6-12-7-4-10-5-11-8(7)13/h4-6H,1-3H2 |
| InChIKey | FOBZLKRMGOIYFF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-(3-chloropropyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3-chloropropyl)purine?
The IUPAC name of 9-(3-chloropropyl)purine (CID 22715671) is 9-(3-chloropropyl)purine.
What is the SMILES notation for 9-(3-chloropropyl)purine?
The canonical SMILES for 9-(3-chloropropyl)purine is ClCCCn1cnc2cncnc21.
What is the InChIKey of 9-(3-chloropropyl)purine?
The InChIKey is FOBZLKRMGOIYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4/c9-2-1-3-13-6-12-7-4-10-5-11-8(7)13/h4-6H,1-3H2.
What are the key properties of 9-(3-chloropropyl)purine?
9-(3-chloropropyl)purine has a molecular weight of 196.64 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3-chloropropyl)purine is sourced from PubChem (CID 22715671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).