About sodium;hydride;9-hydroxypurine
sodium;hydride;9-hydroxypurine (PubChem CID 174050509) has the molecular formula C5H5N4NaO
and a molecular weight of 160.11 g/mol. Its IUPAC name is sodium;hydride;9-hydroxypurine.
Molecular Properties
| Compound Name | sodium;hydride;9-hydroxypurine |
| PubChem CID | 174050509 |
| Molecular Formula | C5H5N4NaO |
| Molecular Weight | 160.11 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | sodium;hydride;9-hydroxypurine |
| SMILES | On1cnc2cncnc21.[H-].[Na+] |
| InChI | InChI=1S/C5H4N4O.Na.H/c10-9-3-8-4-1-6-2-7-5(4)9;;/h1-3,10H;;/q;+1;-1 |
| InChIKey | UCGZYDROPVCXBR-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.11 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;9-hydroxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;9-hydroxypurine?
The IUPAC name of sodium;hydride;9-hydroxypurine (CID 174050509) is sodium;hydride;9-hydroxypurine.
What is the SMILES notation for sodium;hydride;9-hydroxypurine?
The canonical SMILES for sodium;hydride;9-hydroxypurine is On1cnc2cncnc21.[H-].[Na+].
What is the InChIKey of sodium;hydride;9-hydroxypurine?
The InChIKey is UCGZYDROPVCXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O.Na.H/c10-9-3-8-4-1-6-2-7-5(4)9;;/h1-3,10H;;/q;+1;-1.
What are the key properties of sodium;hydride;9-hydroxypurine?
sodium;hydride;9-hydroxypurine has a molecular weight of 160.11 g/mol, XLogP of -2.82, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;9-hydroxypurine is sourced from PubChem (CID 174050509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).