About 9-imidazol-1-ylpurine
9-imidazol-1-ylpurine (PubChem CID 174561773) has the molecular formula C8H6N6
and a molecular weight of 186.18 g/mol. Its IUPAC name is 9-imidazol-1-ylpurine.
Molecular Properties
| Compound Name | 9-imidazol-1-ylpurine |
| PubChem CID | 174561773 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 9-imidazol-1-ylpurine |
| SMILES | c1cn(-n2cnc3cncnc32)cn1 |
| InChI | InChI=1S/C8H6N6/c1-2-13(5-9-1)14-6-12-7-3-10-4-11-8(7)14/h1-6H |
| InChIKey | CXABWTRKEKMOAJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-imidazol-1-ylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-imidazol-1-ylpurine?
The IUPAC name of 9-imidazol-1-ylpurine (CID 174561773) is 9-imidazol-1-ylpurine.
What is the SMILES notation for 9-imidazol-1-ylpurine?
The canonical SMILES for 9-imidazol-1-ylpurine is c1cn(-n2cnc3cncnc32)cn1.
What is the InChIKey of 9-imidazol-1-ylpurine?
The InChIKey is CXABWTRKEKMOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N6/c1-2-13(5-9-1)14-6-12-7-3-10-4-11-8(7)14/h1-6H.
What are the key properties of 9-imidazol-1-ylpurine?
9-imidazol-1-ylpurine has a molecular weight of 186.18 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-imidazol-1-ylpurine is sourced from PubChem (CID 174561773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).