About purin-9-yl sulfite
purin-9-yl sulfite (PubChem CID 57046248) has the molecular formula C5H3N4O3S-
and a molecular weight of 199.17 g/mol. Its IUPAC name is purin-9-yl sulfite.
Molecular Properties
| Compound Name | purin-9-yl sulfite |
| PubChem CID | 57046248 |
| Molecular Formula | C5H3N4O3S- |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | purin-9-yl sulfite |
| SMILES | O=S([O-])On1cnc2cncnc21 |
| InChI | InChI=1S/C5H4N4O3S/c10-13(11)12-9-3-8-4-1-6-2-7-5(4)9/h1-3H,(H,10,11)/p-1 |
| InChIKey | VCVLBZGGTRZEIA-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze purin-9-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of purin-9-yl sulfite?
The IUPAC name of purin-9-yl sulfite (CID 57046248) is purin-9-yl sulfite.
What is the SMILES notation for purin-9-yl sulfite?
The canonical SMILES for purin-9-yl sulfite is O=S([O-])On1cnc2cncnc21.
What is the InChIKey of purin-9-yl sulfite?
The InChIKey is VCVLBZGGTRZEIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4O3S/c10-13(11)12-9-3-8-4-1-6-2-7-5(4)9/h1-3H,(H,10,11)/p-1.
What are the key properties of purin-9-yl sulfite?
purin-9-yl sulfite has a molecular weight of 199.17 g/mol, XLogP of -0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for purin-9-yl sulfite is sourced from PubChem (CID 57046248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).