C21H33BrO4 — CID 22882731
(2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-2-methylheptanoic acid (PubChem CID 22882731) has the molecular formula C21H33BrO4 and a molecular weight of 429.40 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 22882731 |
| Molecular Formula | C21H33BrO4 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-2-methylheptanoic acid |
| SMILES | CC(=O)O[C@](C)(CCC[C@@H](C)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C)C(=O)O |
| InChI | InChI=1S/C21H33BrO4/c1-14(7-5-12-21(4,19(24)25)26-15(2)23)17-9-10-18-16(13-22)8-6-11-20(17,18)3/h13-14,17-18H,5-12H2,1-4H3,(H,24,25)/b16-13+/t14-,17-,18?,20-,21-/m1/s1 |
| InChIKey | WTYXFRMQTDCLST-AQMTUXRISA-N |
| XLogP | 5.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |