C31H34F3N5O6 — CID 22905035
3-[7-[5-(diaminomethylideneamino)pentyl]-1-(naphthalen-1-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905035) has the molecular formula C31H34F3N5O6 and a molecular weight of 629.64 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-1-(naphthalen-1-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-(naphthalen-1-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905035 |
| Molecular Formula | C31H34F3N5O6 |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-(naphthalen-1-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1cccc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H33N5O4.C2HF3O2/c30-29(31)32-15-5-1-2-7-20-12-13-25-24(17-20)28(38)33(16-14-27(36)37)19-26(35)34(25)18-22-10-6-9-21-8-3-4-11-23(21)22;3-2(4,5)1(6)7/h3-4,6,8-13,17H,1-2,5,7,14-16,18-19H2,(H,36,37)(H4,30,31,32);(H,6,7) |
| InChIKey | SBVHEPLYPHHPDU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|