About tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane
tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane (PubChem CID 22955678) has the molecular formula C45H93I
and a molecular weight of 761.14 g/mol. Its IUPAC name is tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane.
Molecular Properties
| Compound Name | tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane |
| PubChem CID | 22955678 |
| Molecular Formula | C45H93I |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.63 |
| IUPAC Name | tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane |
| SMILES | CC(C)C(C(C)C)C(C(C(C)C)C(C)C)I(C(C(C(C)C)C(C)C)C(C(C)C)C(C)C)C(C(C(C)C)C(C)C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C45H93I/c1-25(2)37(26(3)4)43(38(27(5)6)28(7)8)46(44(39(29(9)10)30(11)12)40(31(13)14)32(15)16)45(41(33(17)18)34(19)20)42(35(21)22)36(23)24/h25-45H,1-24H3 |
| InChIKey | NZJPYRDWRSHGGN-UHFFFAOYSA-N |
| XLogP | 15.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane?
The IUPAC name of tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane (CID 22955678) is tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane.
What is the SMILES notation for tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane?
The canonical SMILES for tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane is CC(C)C(C(C)C)C(C(C(C)C)C(C)C)I(C(C(C(C)C)C(C)C)C(C(C)C)C(C)C)C(C(C(C)C)C(C)C)C(C(C)C)C(C)C.
What is the InChIKey of tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane?
The InChIKey is NZJPYRDWRSHGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H93I/c1-25(2)37(26(3)4)43(38(27(5)6)28(7)8)46(44(39(29(9)10)30(11)12)40(31(13)14)32(15)16)45(41(33(17)18)34(19)20)42(35(21)22)36(23)24/h25-45H,1-24H3.
What are the key properties of tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane?
tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane has a molecular weight of 761.14 g/mol, XLogP of 15.17, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane is sourced from PubChem (CID 22955678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).