C24H48 — CID 134834634
1,2,3-tris(2,4-dimethylpentan-3-yl)cyclopropane (PubChem CID 134834634) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 1,2,3-tris(2,4-dimethylpentan-3-yl)cyclopropane.
| Compound Name | 1,2,3-tris(2,4-dimethylpentan-3-yl)cyclopropane |
|---|---|
| PubChem CID | 134834634 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 1,2,3-tris(2,4-dimethylpentan-3-yl)cyclopropane |
| SMILES | CC(C)C(C(C)C)C1C(C(C(C)C)C(C)C)C1C(C(C)C)C(C)C |
| InChI | InChI=1S/C24H48/c1-13(2)19(14(3)4)22-23(20(15(5)6)16(7)8)24(22)21(17(9)10)18(11)12/h13-24H,1-12H3 |
| InChIKey | QOEKOQRMRDPOQM-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |