C23H38O10 — CID 22961517
2-[2-[2-[(Z)-3-methyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]but-2-enoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 22961517) has the molecular formula C23H38O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-[2-[2-[(Z)-3-methyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]but-2-enoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[(Z)-3-methyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]but-2-enoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 22961517 |
| Molecular Formula | C23H38O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-[2-[2-[(Z)-3-methyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]but-2-enoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOC/C=C(/C)COCCOCCOCCOC(=O)C=C |
| InChI | InChI=1S/C23H38O10/c1-4-22(24)32-18-16-29-12-10-27-9-8-26-7-6-21(3)20-31-15-14-28-11-13-30-17-19-33-23(25)5-2/h4-6H,1-2,7-20H2,3H3/b21-6- |
| InChIKey | WEYPHASJFYMXOV-MPUCSWFWSA-N |
| XLogP | 1.49 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|