C26H14N2O2S6 — CID 22982977
14,29-bis(methylsulfanyl)-2,12,17,27-tetrathia-5,20-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4,6,8,10,13,19,21,23,25,28-dodecaene-15,30-dione (PubChem CID 22982977) has the molecular formula C26H14N2O2S6 and a molecular weight of 578.81 g/mol. Its IUPAC name is 14,29-bis(methylsulfanyl)-2,12,17,27-tetrathia-5,20-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4,6,8,10,13,19,21,23,25,28-dodecaene-15,30-dione.
| Compound Name | 14,29-bis(methylsulfanyl)-2,12,17,27-tetrathia-5,20-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4,6,8,10,13,19,21,23,25,28-dodecaene-15,30-dione |
|---|---|
| PubChem CID | 22982977 |
| Molecular Formula | C26H14N2O2S6 |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 577.94 |
| IUPAC Name | 14,29-bis(methylsulfanyl)-2,12,17,27-tetrathia-5,20-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4,6,8,10,13,19,21,23,25,28-dodecaene-15,30-dione |
| SMILES | CSc1c(=O)c2sc3c(sc2c2nc4ccccc4sc12)c(=O)c(SC)c1sc2ccccc2nc13 |
| InChI | InChI=1S/C26H14N2O2S6/c1-31-23-17(29)25-21(15-19(23)33-13-9-5-3-7-11(13)27-15)36-26-18(30)24(32-2)20-16(22(26)35-25)28-12-8-4-6-10-14(12)34-20/h3-10H,1-2H3 |
| InChIKey | AKUPPWMCBATOHN-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|