C20H19N6O3+ — CID 2306822
N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)pyridin-1-ium-3-carboxamide (PubChem CID 2306822) has the molecular formula C20H19N6O3+ and a molecular weight of 391.41 g/mol. Its IUPAC name is N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)pyridin-1-ium-3-carboxamide.
| Compound Name | N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 2306822 |
| Molecular Formula | C20H19N6O3+ |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)pyridin-1-ium-3-carboxamide |
| SMILES | Cn1c(=O)c2[nH]c(-[n+]3cccc(C(=O)NCc4ccccc4)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C20H18N6O3/c1-24-16-15(18(28)25(2)20(24)29)22-19(23-16)26-10-6-9-14(12-26)17(27)21-11-13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3,(H-,21,22,23,27,28)/p+1 |
| InChIKey | JQOLLPZZPYUQRE-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|