C10H22O2Si — CID 23246491
3,3-dimethoxypropyl-dimethyl-[(Z)-prop-1-enyl]silane (PubChem CID 23246491) has the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. Its IUPAC name is 3,3-dimethoxypropyl-dimethyl-[(Z)-prop-1-enyl]silane.
| Compound Name | 3,3-dimethoxypropyl-dimethyl-[(Z)-prop-1-enyl]silane |
|---|---|
| PubChem CID | 23246491 |
| Molecular Formula | C10H22O2Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3,3-dimethoxypropyl-dimethyl-[(Z)-prop-1-enyl]silane |
| SMILES | C/C=C\[Si](C)(C)CCC(OC)OC |
| InChI | InChI=1S/C10H22O2Si/c1-6-8-13(4,5)9-7-10(11-2)12-3/h6,8,10H,7,9H2,1-5H3/b8-6- |
| InChIKey | IPFLGJCSUQJHJQ-VURMDHGXSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|