C23H32N2O6S2Si — CID 23252321
1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylsulfanyl-4-phenoxycarbothioyloxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 23252321) has the molecular formula C23H32N2O6S2Si and a molecular weight of 524.74 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylsulfanyl-4-phenoxycarbothioyloxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylsulfanyl-4-phenoxycarbothioyloxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23252321 |
| Molecular Formula | C23H32N2O6S2Si |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylsulfanyl-4-phenoxycarbothioyloxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CS[C@@H]1[C@H](OC(=S)Oc2ccccc2)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H32N2O6S2Si/c1-23(2,3)34(5,6)28-14-16-18(31-22(32)29-15-10-8-7-9-11-15)19(33-4)20(30-16)25-13-12-17(26)24-21(25)27/h7-13,16,18-20H,14H2,1-6H3,(H,24,26,27)/t16-,18-,19-,20-/m1/s1 |
| InChIKey | UCNNMEFYCKELST-VBSBHUPXSA-N |
| XLogP | 3.94 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|