C17H29FN2O5PS3Si+ — CID 174057066
1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(2-sulfanyl-1,3,2-dithiaphospholan-2-ium-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 174057066) has the molecular formula C17H29FN2O5PS3Si+ and a molecular weight of 515.69 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(2-sulfanyl-1,3,2-dithiaphospholan-2-ium-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(2-sulfanyl-1,3,2-dithiaphospholan-2-ium-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174057066 |
| Molecular Formula | C17H29FN2O5PS3Si+ |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(2-sulfanyl-1,3,2-dithiaphospholan-2-ium-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](F)[C@@H]1O[P+]1(S)SCCS1 |
| InChI | InChI=1S/C17H28FN2O5PS3Si/c1-17(2,3)30(4,5)23-10-11-14(25-26(27)28-8-9-29-26)13(18)15(24-11)20-7-6-12(21)19-16(20)22/h6-7,11,13-15,27H,8-10H2,1-5H3/p+1/t11-,13-,14-,15-/m1/s1 |
| InChIKey | SIUKXZSXJQSQSQ-NMFUWQPSSA-O |
| XLogP | 4.27 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|