C14H9ClF3N3O4S — CID 23315695
(2E)-2-[(4-chlorophenyl)methoxyimino]-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 23315695) has the molecular formula C14H9ClF3N3O4S and a molecular weight of 407.76 g/mol. Its IUPAC name is (2E)-2-[(4-chlorophenyl)methoxyimino]-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2E)-2-[(4-chlorophenyl)methoxyimino]-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 23315695 |
| Molecular Formula | C14H9ClF3N3O4S |
| Molecular Weight | 407.76 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | (2E)-2-[(4-chlorophenyl)methoxyimino]-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)/C(=N/OCc1ccc(Cl)cc1)c1csc(NC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H9ClF3N3O4S/c15-8-3-1-7(2-4-8)5-25-21-10(11(22)23)9-6-26-13(19-9)20-12(24)14(16,17)18/h1-4,6H,5H2,(H,22,23)(H,19,20,24)/b21-10+ |
| InChIKey | CTMRAUBNORMECR-UFFVCSGVSA-N |
| XLogP | 3.30 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|