C26H25F3O5 — CID 23325097
1-[(2-methylphenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 23325097) has the molecular formula C26H25F3O5 and a molecular weight of 474.48 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | 1-[(2-methylphenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 23325097 |
| Molecular Formula | C26H25F3O5 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[(2-methylphenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | Cc1ccccc1COC(C)OC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H25F3O5/c1-17-6-4-5-7-20(17)16-31-19(3)33-25(30)18(2)32-22-12-14-24(15-13-22)34-23-10-8-21(9-11-23)26(27,28)29/h4-15,18-19H,16H2,1-3H3 |
| InChIKey | CRAFHYKYYZPBME-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|