C10H5BrCl2F3NO — CID 2335486
(Z)-3-bromo-4-(2,4-dichloroanilino)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 2335486) has the molecular formula C10H5BrCl2F3NO and a molecular weight of 362.96 g/mol. Its IUPAC name is (Z)-3-bromo-4-(2,4-dichloroanilino)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (Z)-3-bromo-4-(2,4-dichloroanilino)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 2335486 |
| Molecular Formula | C10H5BrCl2F3NO |
| Molecular Weight | 362.96 g/mol |
| Exact Mass | 360.89 |
| IUPAC Name | (Z)-3-bromo-4-(2,4-dichloroanilino)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(/C(Br)=C/Nc1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H5BrCl2F3NO/c11-6(9(18)10(14,15)16)4-17-8-2-1-5(12)3-7(8)13/h1-4,17H/b6-4- |
| InChIKey | UDGKCFSEWVGYCU-XQRVVYSFSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|