C27H42O4Si2 — CID 23542279
CID 23542279 (PubChem CID 23542279) has the molecular formula C27H42O4Si2 and a molecular weight of 486.80 g/mol.
| Compound Name | CID 23542279 |
|---|---|
| PubChem CID | 23542279 |
| Molecular Formula | C27H42O4Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | — |
| SMILES | CC(O)[Si](C)CCCOc1ccc(C(C)(C)c2ccc(OCCC[Si](C)C(C)O)cc2)cc1 |
| InChI | InChI=1S/C27H42O4Si2/c1-21(28)32(5)19-7-17-30-25-13-9-23(10-14-25)27(3,4)24-11-15-26(16-12-24)31-18-8-20-33(6)22(2)29/h9-16,21-22,28-29H,7-8,17-20H2,1-6H3 |
| InChIKey | STXIMZMHEIOHFD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|