C30H23N5O3 — CID 23596274
N-(5-isoquinolin-5-yl-1H-imidazol-2-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596274) has the molecular formula C30H23N5O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-(5-isoquinolin-5-yl-1H-imidazol-2-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-(5-isoquinolin-5-yl-1H-imidazol-2-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596274 |
| Molecular Formula | C30H23N5O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-(5-isoquinolin-5-yl-1H-imidazol-2-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2ncc(-c3cccc4cnccc34)[nH]2)CC2([N+](=O)[O-])c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C30H23N5O3/c1-29(27(36)34-28-32-16-25(33-28)20-10-6-7-18-15-31-14-13-19(18)20)17-30(35(37)38)23-11-4-2-8-21(23)26(29)22-9-3-5-12-24(22)30/h2-16,26H,17H2,1H3,(H2,32,33,34,36) |
| InChIKey | WMZCSNRUVQECHD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|