About 11-methylnaphtho[1,2-b][1]benzothiol-11-ium
11-methylnaphtho[1,2-b][1]benzothiol-11-ium (PubChem CID 23656154) has the molecular formula C17H13S+
and a molecular weight of 249.36 g/mol. Its IUPAC name is 11-methylnaphtho[1,2-b][1]benzothiol-11-ium.
Molecular Properties
| Compound Name | 11-methylnaphtho[1,2-b][1]benzothiol-11-ium |
| PubChem CID | 23656154 |
| Molecular Formula | C17H13S+ |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 11-methylnaphtho[1,2-b][1]benzothiol-11-ium |
| SMILES | C[s+]1c2ccccc2c2ccc3ccccc3c21 |
| InChI | InChI=1S/C17H13S/c1-18-16-9-5-4-8-14(16)15-11-10-12-6-2-3-7-13(12)17(15)18/h2-11H,1H3/q+1 |
| InChIKey | KBVBPVJVVSBGBV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 11-methylnaphtho[1,2-b][1]benzothiol-11-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methylnaphtho[1,2-b][1]benzothiol-11-ium?
The IUPAC name of 11-methylnaphtho[1,2-b][1]benzothiol-11-ium (CID 23656154) is 11-methylnaphtho[1,2-b][1]benzothiol-11-ium.
What is the SMILES notation for 11-methylnaphtho[1,2-b][1]benzothiol-11-ium?
The canonical SMILES for 11-methylnaphtho[1,2-b][1]benzothiol-11-ium is C[s+]1c2ccccc2c2ccc3ccccc3c21.
What is the InChIKey of 11-methylnaphtho[1,2-b][1]benzothiol-11-ium?
The InChIKey is KBVBPVJVVSBGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13S/c1-18-16-9-5-4-8-14(16)15-11-10-12-6-2-3-7-13(12)17(15)18/h2-11H,1H3/q+1.
What are the key properties of 11-methylnaphtho[1,2-b][1]benzothiol-11-ium?
11-methylnaphtho[1,2-b][1]benzothiol-11-ium has a molecular weight of 249.36 g/mol, XLogP of 5.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methylnaphtho[1,2-b][1]benzothiol-11-ium is sourced from PubChem (CID 23656154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).