C17H19Cl3N8OS — CID 2369916
(2S)-2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2369916) has the molecular formula C17H19Cl3N8OS and a molecular weight of 489.82 g/mol. Its IUPAC name is (2S)-2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2369916 |
| Molecular Formula | C17H19Cl3N8OS |
| Molecular Weight | 489.82 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (2S)-2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CCNc1nc(NCC)n2c(S[C@@H](C)C(=O)Nc3cc(Cl)c(Cl)cc3Cl)nnc2n1 |
| InChI | InChI=1S/C17H19Cl3N8OS/c1-4-21-14-24-15(22-5-2)28-16(25-14)26-27-17(28)30-8(3)13(29)23-12-7-10(19)9(18)6-11(12)20/h6-8H,4-5H2,1-3H3,(H,23,29)(H2,21,22,24,25,26)/t8-/m0/s1 |
| InChIKey | RZUDRFOZGZJQKY-QMMMGPOBSA-N |
| XLogP | 4.46 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|