C17H16ClN3OS3 — CID 23739544
N-[(4-tert-butyl-1,3-thiazol-2-yl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 23739544) has the molecular formula C17H16ClN3OS3 and a molecular weight of 409.99 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 23739544 |
| Molecular Formula | C17H16ClN3OS3 |
| Molecular Weight | 409.99 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)n1 |
| InChI | InChI=1S/C17H16ClN3OS3/c1-17(2,3)11-8-24-16(19-11)21-15(23)20-14(22)13-12(18)9-6-4-5-7-10(9)25-13/h4-8H,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | UVTVQVSJSOCMAW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.99 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|