C24H27N3O3S — CID 23828020
3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23828020) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23828020 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\C(C)C)n2N=C2CCc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O3S/c1-15(2)25-24-27(26-19-11-10-16-8-6-7-9-18(16)19)20(14-31-24)17-12-21(28-3)23(30-5)22(13-17)29-4/h6-9,12-15H,10-11H2,1-5H3/b25-24-,26-19? |
| InChIKey | AVMXECVEJQXQFC-RHIXKDPBSA-N |
| XLogP | 4.75 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|