C21H21N3OS — CID 23827708
3-(2,3-dihydroinden-1-ylideneamino)-N-ethyl-4-(2-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23827708) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 3-(2,3-dihydroinden-1-ylideneamino)-N-ethyl-4-(2-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-ethyl-4-(2-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23827708 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-ethyl-4-(2-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2OC)n1N=C1CCc2ccccc21 |
| InChI | InChI=1S/C21H21N3OS/c1-3-22-21-24(23-18-13-12-15-8-4-5-9-16(15)18)19(14-26-21)17-10-6-7-11-20(17)25-2/h4-11,14H,3,12-13H2,1-2H3/b22-21-,23-18? |
| InChIKey | LYXBFZTVUBZGGL-UJRGUCKDSA-N |
| XLogP | 4.34 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|